2-Fluoro-5-formylbenzoic acid manufacturers
|
| | 2-Fluoro-5-formylbenzoic acid Basic information |
| Product Name: | 2-Fluoro-5-formylbenzoic acid | | Synonyms: | 2-FLUORO-5-FORMYLBENZOIC ACID 95;2-Fluoro-5-formylbenzoic acid 95%;3-Carboxy-4-fluorobenzaldehyde;5-(1,3-dioxolan-2-yl)-2-fluorobenzoic acid;Olaparib Imp.33;Benzoic acid, 2-fluoro-5-formyl-;2-FLUORO-5-FORMYLBENZOIC ACID 95 ISO 9001：2015 REACH;2-FLUORO-5-FORMYLBENZOIC ACID | | CAS: | 550363-85-4 | | MF: | C8H5FO3 | | MW: | 168.12 | | EINECS: | | | Product Categories: | john's | | Mol File: | 550363-85-4.mol |  |
| | 2-Fluoro-5-formylbenzoic acid Chemical Properties |
| Melting point | 174.5-178.5 | | Boiling point | 330.9±27.0 °C(Predicted) | | density | 1.426±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 2.92±0.10(Predicted) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C8H5FO3/c9-7-2-1-5(4-10)3-6(7)8(11)12/h1-4H,(H,11,12) | | InChIKey | XZUFXXPSLGVLFC-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(C=O)=CC=C1F |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | Hazard Note | Harmful | | HazardClass | IRRITANT | | HS Code | 2918300090 |
| | 2-Fluoro-5-formylbenzoic acid Usage And Synthesis |
| Description | 2-Fluoro-5-formylbenzoic acid is an important pharmaceutical intermediate compound used in the preparation of active pharmaceutical ingredients such as olaparib, interleukin-1 receptor-associated kinase 4 (IRAK4) degraders and PARP7 inhibitors. | | Uses |
2-Fluoro-5-formylbenzoic acid is an aldehyde compound that can be used to prepare a key intermediate for olaparib. This substance is used to prepare olaparib intermediates via the Wittig–Horner reaction. However, the aldehyde compound itself is unstable and possesses reducing properties, making it prone to oxidation to a carboxylic acid. Consequently, the key olaparib intermediate I produced via this reaction invariably contains impurities in the form of related substances. Furthermore, the reaction requires inert gas protection and anhydrous reaction conditions, making the process complex to carry out.
|
| | 2-Fluoro-5-formylbenzoic acid Preparation Products And Raw materials |
|