| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 7-Amino-1,3-naphthalenedisulfonic acid, monopotassium salt, hydrate, 99 Basic information |
| Product Name: | 7-Amino-1,3-naphthalenedisulfonic acid, monopotassium salt, hydrate, 99 | | Synonyms: | 2-Naphthylamine-6,8-disulfonic acid hydrate monopotassium salt, AGA, 7-Amino-1,3-naphthalenedisulfonic acid hydrate monopotassium salt;7-Amino-1,3-naphthalenedisulfonic acid, monopotassium salt, hydrate, 99 | | CAS: | 332360-04-0 | | MF: | C10H12KNO7S2 | | MW: | 361.42 | | EINECS: | | | Product Categories: | | | Mol File: | 332360-04-0.mol |  |
| | 7-Amino-1,3-naphthalenedisulfonic acid, monopotassium salt, hydrate, 99 Chemical Properties |
| Melting point | >300 °C(lit.) | | InChI | 1S/C10H9NO6S2.K.H2O/c11-7-2-1-6-3-8(18(12,13)14)5-10(9(6)4-7)19(15,16)17;;/h1-5H,11H2,(H,12,13,14)(H,15,16,17);;1H2/q;+1;/p-1 | | InChIKey | SHURQDDWGCOLFA-UHFFFAOYSA-M | | SMILES | [K+].[H]O[H].Nc1ccc2cc(cc(c2c1)S(O)(=O)=O)S([O-])(=O)=O |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | 7-Amino-1,3-naphthalenedisulfonic acid, monopotassium salt, hydrate, 99 Usage And Synthesis |
| Chemical Properties | slightly yellow to beige crystalline powder | | Uses | Monopotassium 7-amino-1,3-naphthalenedisulfonate may be used to conjugate the reducing ends of oligosaccharides, such as those derived from glycoproteins, glycolipids, and proteoglycans, for analysis via gel electrophoresis. |
| | 7-Amino-1,3-naphthalenedisulfonic acid, monopotassium salt, hydrate, 99 Preparation Products And Raw materials |
|