| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 69218 Saxitoxin in acetic acid (determi Basic information |
| Product Name: | 69218 Saxitoxin in acetic acid (determi | | Synonyms: | paralyticshellfishpoisondihydrochloride;saxitoxindihydrochloride;saxitoxinhydrochloride;stxdihydrochloride;69218, Saxitoxin in acetic acid (determination in mussel);1H,10H-Pyrrolo1,2-cpurine-10,10-diol, 2,6-diamino-4-(aminocarbonyl)oxymethyl-3a,4,8,9-tetrahydro-, dihydrochloride, (3aS,4R,10aS)-;PARALYTICSHELLFISHTOXINS;PARALYTICSHELLFISHPOISON | | CAS: | 35554-08-6 | | MF: | C10H18ClN7O4 | | MW: | 335.75 | | EINECS: | | | Product Categories: | | | Mol File: | 35554-08-6.mol |  |
| | 69218 Saxitoxin in acetic acid (determi Chemical Properties |
| storage temp. | -20°C | | Major Application | cleaning products
cosmetics
food and beverages
personal care | | InChI | 1S/C10H17N7O4.2ClH/c11-6-15-5-4(3-21-8(13)18)14-7(12)17-2-1-9(19,20)10(5,17)16-6;;/h4-5,19-20H,1-3H2,(H2,12,14)(H2,13,18)(H3,11,15,16);2*1H | | InChIKey | YHAHUGQQOBPXOZ-UHFFFAOYSA-N | | SMILES | [H][C@@]12[C@]3(NC(N2)=N)N(CCC3(O)O)C(N[C@H]1COC(N)=O)=N |
| | 69218 Saxitoxin in acetic acid (determi Usage And Synthesis |
| Uses | cleaning products
cosmetics
food and beverages
personal care |
| | 69218 Saxitoxin in acetic acid (determi Preparation Products And Raw materials |
|