| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Methyl-d3 tribromoacetate, 98 atom % D Basic information |
| | Methyl-d3 tribromoacetate, 98 atom % D Chemical Properties |
| Boiling point | 103 °C/15 mmHg (lit.) | | density | 2.353 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.558(lit.) | | Fp | >230 °F | | InChI | 1S/C3H3Br3O2/c1-8-2(7)3(4,5)6/h1H3/i1D3 | | InChIKey | QQHSHLKOWBDOFC-FIBGUPNXSA-N | | SMILES | [2H]C([2H])([2H])OC(=O)C(Br)(Br)Br |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Methyl-d3 tribromoacetate, 98 atom % D Usage And Synthesis |
| Uses | For the determination of tribromomethane in wastewater. |
| | Methyl-d3 tribromoacetate, 98 atom % D Preparation Products And Raw materials |
|