| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2 2 2 3' 4'-PENTAFLUOROACETOPHENONE 95 Basic information |
| Product Name: | 2 2 2 3' 4'-PENTAFLUOROACETOPHENONE 95 | | Synonyms: | 2 2 2 3' 4'-PENTAFLUOROACETOPHENONE 95;Ethanone, 1-(3,4-difluorophenyl)-2,2,2-trifluoro- (9CI);2,2,2,3',4'-Pentafluoroacetophenone 95%;Ethanone, 1-(3,4-difluorophenyl)-2,2,2-trifluoro-;2,2,2,3',4'-Pentafluoroacetophenone;2,2,2,3′;2,2,2,3′,4′-Pentafluoroacetophenone, CAS 302912-28-3 | | CAS: | 302912-28-3 | | MF: | C8H3F5O | | MW: | 210.1 | | EINECS: | | | Product Categories: | ACETYLHALIDE;C7 to C8;Carbonyl Compounds;Ketones | | Mol File: | 302912-28-3.mol |  |
| | 2 2 2 3' 4'-PENTAFLUOROACETOPHENONE 95 Chemical Properties |
| Boiling point | 150 °C(lit.) | | density | 1.464 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.4375(lit.) | | Fp | 125 °F | | InChI | 1S/C8H3F5O/c9-5-2-1-4(3-6(5)10)7(14)8(11,12)13/h1-3H | | InChIKey | WEKSIOBQIQXAEE-UHFFFAOYSA-N | | SMILES | Fc1ccc(cc1F)C(=O)C(F)(F)F |
| Risk Statements | 10 | | Safety Statements | 16 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | HS Code | 2914790090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | 2 2 2 3' 4'-PENTAFLUOROACETOPHENONE 95 Usage And Synthesis |
| | 2 2 2 3' 4'-PENTAFLUOROACETOPHENONE 95 Preparation Products And Raw materials |
|