| Company Name: |
Zhengzhou Haochuang New Material Co., Ltd. Gold
|
| Tel: |
19139721821; 19139721821 |
| Email: |
3545426645@qq.com |
| Products Intro: |
Product Name:2,4,6-Tris(diphenylamino)-5-fluoroisophthalonitrile
CAS:2260543-73-3
Purity:98% Package:25g 50g 100g 250g 500g
|
|
| | 3DPAFIPN Basic information |
| Product Name: | 3DPAFIPN | | Synonyms: | 3DPAFIPN;1,3-Benzenedicarbonitrile, 2,4,6-tris(diphenylamino)-5-fluoro-;2,4,6-Tris(diphenylamino)-5-fluoroisophthalonitrile | | CAS: | 2260543-73-3 | | MF: | C44H30FN5 | | MW: | 647.74 | | EINECS: | | | Product Categories: | | | Mol File: | 2260543-73-3.mol |  |
| | 3DPAFIPN Chemical Properties |
| Melting point | 307-401 °C | | Boiling point | 806.2±65.0 °C(Predicted) | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | -7.10±0.50(Predicted) | | form | powder | | Appearance | Light yellow to yellow Solid | | InChIKey | GCGRXVMGBHYMDA-UHFFFAOYSA-N | | SMILES | C1(C#N)=C(N(C2=CC=CC=C2)C2=CC=CC=C2)C(F)=C(N(C2=CC=CC=C2)C2=CC=CC=C2)C(C#N)=C1N(C1=CC=CC=C1)C1=CC=CC=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 3DPAFIPN Usage And Synthesis |
| Uses | 3DPAFIPN is cyanoarene-based donor-acceptor photocatalyst developed by the Zeitler group. | | reaction suitability | reaction type: Photocatalysis
reagent type: catalyst |
| | 3DPAFIPN Preparation Products And Raw materials |
|