BODIPY 581/591 carboxylic acid manufacturers
|
| | BODIPY 581/591 carboxylic acid Basic information |
| | BODIPY 581/591 carboxylic acid Chemical Properties |
| solubility | Soluble in DMF, DMSO, DCM | | Appearance | dark powder | | ex/em | λex 582 nm; λem 590 nm | | InChI | InChI=1S/C22H19BF2N2O2/c24-23(25)26-18(9-5-4-8-17-6-2-1-3-7-17)10-12-20(26)16-21-13-11-19(27(21)23)14-15-22(28)29/h1-13,16H,14-15H2,(H,28,29) | | InChIKey | BNURWCMGIJOEAC-UHFFFAOYSA-N | | SMILES | [F-][B+3]1(N2=C(C=CC2=CC2=CC=C(CCC(=O)[O-])[N-]12)C=CC=CC1C=CC=CC=1)[F-].[H+] |
| | BODIPY 581/591 carboxylic acid Usage And Synthesis |
| Description | BDP 581/591 carboxylic acid is a BDP linker containing a carboxylic acid. The BDP 581/591 is very photostable. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | | Uses | BDP 581/591 carboxylic acid is a fluorescent dye (Ex=585 nm, Em=594 nm). BDP 581/591 carboxylic acid has a free carboxylic acid group, which can be catalyzed by a catalyst (such as EDC or HATU) to react with primary amines to form stable amide bonds. BDP 581/591 carboxylic acid is highly photostable and can be used for ROS detection. | | Abs/Em Maxima | 585/594 nm | | Fluoresene quantum yield | 0.83 | | Extinction Coefficient | 104000 | | CF260 | 0.06 | | CF280 | 0.04 |
| | BODIPY 581/591 carboxylic acid Preparation Products And Raw materials |
|