| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2-Bromo-5-(trifluoromethyl)benzenesulfonyl chloride Basic information |
| | 2-Bromo-5-(trifluoromethyl)benzenesulfonyl chloride Chemical Properties |
| Boiling point | 230-231 °C (lit.) | | density | 1.854 g/mL at 25 °C (lit.) | | refractive index | n20/D >1.5290(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | fused / liquid solid | | color | Pale lemon | | Sensitive | Moisture Sensitive | | InChI | 1S/C7H3BrClF3O2S/c8-5-2-1-4(7(10,11)12)3-6(5)15(9,13)14/h1-3H | | InChIKey | CBIFOAHDKKGDAC-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1ccc(Br)c(c1)S(Cl)(=O)=O | | CAS DataBase Reference | 176225-08-4(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 34 | | Safety Statements | 26-27-36/37/39-45-20 | | RIDADR | UN 1760 8/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29049090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | 2-Bromo-5-(trifluoromethyl)benzenesulfonyl chloride Usage And Synthesis |
| | 2-Bromo-5-(trifluoromethyl)benzenesulfonyl chloride Preparation Products And Raw materials |
|