|
|
| | 4,4'-Hexamethylenebis(1,1-dimethylsemicarbazide) Basic information |
| Product Name: | 4,4'-Hexamethylenebis(1,1-dimethylsemicarbazide) | | Synonyms: | N,N'-(Hexane-1,6-diyl)bis(2,2-dimethylhydrazinecarboxamide);HN-130;hydrazinecarboxamide,n,n’1,6hexanediylbis[2,2dimethyl;hydrazinecarboxamide,n,n’-1,6-hexanediylbis[2,2-dimethyl-;N,N’-1,6-hexanediyl-bis(2,2-dimethyl)-Hydrazinecarboxamide;1,6-BIS[3-(DIMETHYLAMINO)UREIDO]HEXANE;1,6-hexamethylene bis(n,n-dimethylsemicarbazide);4,4''-HEXAMETHYLENEBIS(1,1-DIMETHYLSEMICARBAZIDE) EP | | CAS: | 69938-76-7 | | MF: | C12H28N6O2 | | MW: | 288.39 | | EINECS: | | | Product Categories: | | | Mol File: | 69938-76-7.mol |  |
| | 4,4'-Hexamethylenebis(1,1-dimethylsemicarbazide) Chemical Properties |
| Melting point | 144.0 to 148.0 °C | | density | 1.065±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 11.79±0.50(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C12H28N6O2/c1-17(2)15-11(19)13-9-7-5-6-8-10-14-12(20)16-18(3)4/h5-10H2,1-4H3,(H2,13,15,19)(H2,14,16,20) | | InChIKey | VETHREXFBVHLJJ-UHFFFAOYSA-N | | SMILES | C(NC(NN(C)C)=O)CCCCCNC(NN(C)C)=O | | CAS DataBase Reference | 69938-76-7(CAS DataBase Reference) | | EPA Substance Registry System | Hydrazinecarboxamide, N,N'-1,6-hexanediylbis[2,2-dimethyl- (69938-76-7) |
| TSCA | TSCA listed | | HS Code | 2928.00.5000 |
| | 4,4'-Hexamethylenebis(1,1-dimethylsemicarbazide) Usage And Synthesis |
| Uses | 4,4'-Hexamethylenebis(1,1-dimethylsemicarbazide) is also known as anti-yellowing agent HN-130. It is widely used in the production process of PU profiles, shoe materials, plastics, and polyurethane fibers to prevent yellowing during processing; this product can also be used as an antioxidant and stabilizer and can participate in polymerization reactions; it can also be used Used as an anti-yellowing agent in polyurethane coatings. |
| | 4,4'-Hexamethylenebis(1,1-dimethylsemicarbazide) Preparation Products And Raw materials |
|