|
|
| | H-GAMMA-GLU-PHE-OH Basic information |
| Product Name: | H-GAMMA-GLU-PHE-OH | | Synonyms: | H-GLU(PHE)-OH;H-GLU(PHE-OH)-OH;H-GAMMA-GLU-PHE-OH;N-L-gamma-glutamyl-3-phenyl-L-alanine;(2S)-2-amino-5-[[(2S)-1-hydroxy-1-oxo-3-phenylpropan-2-yl]amino]-5-oxopentanoic acid;Glutamylphenylalanine;gamma-glutamylphenylalanine;L-Y-GLUTAMYL-L-PHENYLALANINE | | CAS: | 7432-24-8 | | MF: | C14H18N2O5 | | MW: | 294.3 | | EINECS: | 231-077-0 | | Product Categories: | | | Mol File: | 7432-24-8.mol |  |
| | H-GAMMA-GLU-PHE-OH Chemical Properties |
| Melting point | 194-197 °C | | Boiling point | 622.0±55.0 °C(Predicted) | | density | 1.332±0.06 g/cm3(Predicted) | | storage temp. | -15°C | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | pka | 2.22±0.10(Predicted) | | color | White to Off-White | | Water Solubility | water: slightly soluble | | Sequence | γ-Glu-Phe-OH | | InChI | 1S/C14H18N2O5/c15-10(13(18)19)6-7-12(17)16-11(14(20)21)8-9-4-2-1-3-5-9/h1-5,10-11H,6-8,15H2,(H,16,17)(H,18,19)(H,20,21)/t10-,11-/m0/s1 | | InChIKey | XHHOHZPNYFQJKL-QWRGUYRKSA-N | | SMILES | N([C@@H](Cc1ccccc1)C(=O)O)C(=O)CC[C@H](N)C(=O)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | H-GAMMA-GLU-PHE-OH Usage And Synthesis |
| Uses | γ-Glutamylphenylalanine Trifluoroacetic Acid Salt is found in the urine of newborn untreated patients with phenylketonuria, and is not found in healthy patients. γ-Glutamylphenylalanine is a potential biomarker for the early detection of drug-induced nephrotoxicity | | Definition | ChEBI: A dipeptide obtained by formal condensation of the side-chain carboxy group of L-glutamic acid with the amino group of L-phenylalanine. | | IC 50 | Microbial Metabolite; Human Endogenous Metabolite |
| | H-GAMMA-GLU-PHE-OH Preparation Products And Raw materials |
|