- Herbal Propionate
-
- $45.00
-
2025-05-23
- CAS:17511-60-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20 tons
- florocyclene
-
- $12.99
-
2022-02-25
- CAS:17511-60-3
- Min. Order: 500g/Bag
- Purity: 99%
- Supply Ability: 30kg
|
| | HERBAL PROPIONATE Basic information |
| Product Name: | HERBAL PROPIONATE | | Synonyms: | 7-methanoinden-6-ol,3a,4,5,6,7,7a-hexahydro-propionate;7-methanoindene-6-carboxylicacid,3a,4,5,6,7,7a-hexahydro-ethylester;Tricyclo[5.2.1.O2,6]dec-3-en-8-ylpropionate;4,7-Methano-1H-inden-6-ol,3a,4,5,6,7,7a-hexahydro-,propanoate;4,7-Methanoinden-6-ol,3a,4,5,6,7,7a-hexahydro-,propionate;7-methano-1h-inden-6-ol,3a,4,5,6,7,7a-hexahydro-propanoate;3A,4,5,6,7,7A-HEXAHYDRO-4,7-METHANO-1H-INDEN-5(6)-YL PROPIONATE;tricyclodecenepropionate | | CAS: | 17511-60-3 | | MF: | C13H18O2 | | MW: | 206.28 | | EINECS: | 241-514-7 | | Product Categories: | | | Mol File: | 17511-60-3.mol |  |
| | HERBAL PROPIONATE Chemical Properties |
| Boiling point | 305.14°C (rough estimate) | | density | 1.0176 (rough estimate) | | refractive index | 1.4860 (estimate) | | Odor | at 100.00 %. fruity herbal woody jasmin oily basil | | Odor Type | herbal | | Cosmetics Ingredients Functions | DEODORANT
PERFUMING
FRAGRANCE | | InChI | InChI=1S/C13H18O2/c1-2-13(14)15-12-7-8-6-11(12)10-5-3-4-9(8)10/h3-4,8-12H,2,5-7H2,1H3 | | InChIKey | BLBJUGKATXCWET-UHFFFAOYSA-N | | SMILES | C1C2C(C3CC2C(OC(=O)CC)C3)C=C1 | | LogP | 3.628 (est) | | EPA Substance Registry System | 4,7-Methano-1H-inden-6-ol, 3a,4,5,6,7,7a-hexahydro-, propanoate (17511-60-3) |
| TSCA | TSCA listed | | Toxicity | skn-rbt 500 mg/24H MOD FCTXAV 17,911,79 |
| | HERBAL PROPIONATE Usage And Synthesis |
| Chemical Properties | Colorless, transparent liquid with a woody floral aroma. | | Safety Profile | A skin irritant. When heated todecomposition it emits acrid smoke and irritating vapors. |
| | HERBAL PROPIONATE Preparation Products And Raw materials |
|