- HOLMIUM ACETATE
-
- $1.00
-
2019-09-04
- CAS:312619-49-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kg
|
| | HOLMIUM ACETATE Basic information |
| | HOLMIUM ACETATE Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | form | Crystalline Aggregates | | Water Solubility | Soluble in water. | | Sensitive | Hygroscopic | | InChI | 1S/3C2H4O2.Ho.H2O/c3*1-2(3)4;;/h3*1H3,(H,3,4);;1H2/q;;;+3;/p-3 | | InChIKey | LCCGYXRQAXROOW-UHFFFAOYSA-K | | SMILES | O.CC(=O)O[Ho](OC(C)=O)OC(C)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | Yes | | HS Code | 2915290000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | HOLMIUM ACETATE Usage And Synthesis |
| Uses | DYSPROSIUM(III) ACETATE TETRAHYDRATE, REACTON®, 99.9% (REO) has specialized uses in ceramics, glass, phosphors, lasers and Dysprosium Metal halide lamp. High purity of Dysprosium Aceate is used in electronics industry as an antireflection coating in photoelectric devices. Dysprosium and its compounds are highly susceptible to magnetization, they are employed in various data-storage applications, such as in hard disks. It is also used in dosimeters for measuring ionizing radiation. | | Uses | Holmium(III) acetate hydrate is used as laboratory reagent, optical glasses, structural ceramics, catalysts, electrical components and photo-optical material. | | reaction suitability | core: holmium reagent type: catalyst |
| | HOLMIUM ACETATE Preparation Products And Raw materials |
|