| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,4-Difluorophenylglyoxal hydrate Basic information |
| Product Name: | 2,4-Difluorophenylglyoxal hydrate | | Synonyms: | 2,4-DIFLUOROPHENYLGLYOXAL MONOHYDRATE;2-(2,4-DIFLUOROPHENYL)-2-OXOACETALDEHYDE;2,4-DIFLUOROPHENYLGLYOXAL HYDRATE , DRY WT. BASIS;2,4-Difluorophenylglyoxal hydrate, 95%, dry wt. basis;2,4-Difluorophenylglyoxal;Benzeneacetaldehyde, 2,4-difluoro-α-oxo-;2,4-Difluorophenylglyoxal hydrate | | CAS: | 79784-36-4 | | MF: | C8H4F2O2 | | MW: | 170.11 | | EINECS: | | | Product Categories: | | | Mol File: | 79784-36-4.mol |  |
| | 2,4-Difluorophenylglyoxal hydrate Chemical Properties |
| Melting point | 51-54°C | | Boiling point | 60-64 °C(Press: 4 Torr) | | density | 1.342±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | Water Solubility | Soluble in water. | | BRN | 4387465 | | InChI | 1S/C8H4F2O2.H2O/c9-5-1-2-6(7(10)3-5)8(12)4-11;/h1-4H;1H2 | | InChIKey | BILNRTMGRXGXSV-UHFFFAOYSA-N | | SMILES | [H]O[H].FC1=C(C=CC(F)=C1)C(C([H])=O)=O | | CAS DataBase Reference | 79784-36-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | HazardClass | IRRITANT | | HS Code | 2912190090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| Provider | Language |
|
ALFA
| English |
| | 2,4-Difluorophenylglyoxal hydrate Usage And Synthesis |
| Uses | Used in the synthesis of biologically active 1,2,4-triazine derivatives. Also used as pharmaceutical intermediate. |
| | 2,4-Difluorophenylglyoxal hydrate Preparation Products And Raw materials |
|