| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:1,1,7,7-tetramethyl-9-formyljulolidine
|
| Company Name: |
Riedel-de Haen AG
|
| Tel: |
800 558-9160 |
| Email: |
|
| Products Intro: |
Purity:AldrichCPR
|
| Company Name: |
Fluorochem Ltd
|
| Tel: |
(01457) 868921 (4 lines) |
| Email: |
vernam@fluorochem.co.uk |
| Products Intro: |
|
|
| | 1,1,7,7-TETRAMETHYL-2,3,6,7-TETRAHYDRO-1H,5H-PYRIDO[3,2,1-IJ]QUINOLINE-9-CARBALDEHYDE Basic information |
| Product Name: | 1,1,7,7-TETRAMETHYL-2,3,6,7-TETRAHYDRO-1H,5H-PYRIDO[3,2,1-IJ]QUINOLINE-9-CARBALDEHYDE | | Synonyms: | 1,1,7,7-TETRAMETHYL-2,3,6,7-TETRAHYDRO-1H,5H-PYRIDO[3,2,1-IJ]QUINOLINE-9-CARBALDEHYDE;1,1,7,7-TETRAMETHYL-9-FORMYLJULOLIDINE | | CAS: | | | MF: | C17H23NO | | MW: | 257.37 | | EINECS: | | | Product Categories: | Quinoline&Isoquinoline | | Mol File: | Mol File | ![1,1,7,7-TETRAMETHYL-2,3,6,7-TETRAHYDRO-1H,5H-PYRIDO[3,2,1-IJ]QUINOLINE-9-CARBALDEHYDE Structure](StructureFile/ChemBookStructure9/GIF/CB8704092.gif) |
| | 1,1,7,7-TETRAMETHYL-2,3,6,7-TETRAHYDRO-1H,5H-PYRIDO[3,2,1-IJ]QUINOLINE-9-CARBALDEHYDE Chemical Properties |
| form | solid | | InChI | 1S/C17H23NO/c1-16(2)5-7-18-8-6-17(3,4)14-10-12(11-19)9-13(16)15(14)18/h9-11H,5-8H2,1-4H3 | | InChIKey | FDVCQFAKOKLXGE-UHFFFAOYSA-N | | SMILES | CC1(C)CCN2CCC(C)(C)c3cc(C=O)cc1c23 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 1,1,7,7-TETRAMETHYL-2,3,6,7-TETRAHYDRO-1H,5H-PYRIDO[3,2,1-IJ]QUINOLINE-9-CARBALDEHYDE Usage And Synthesis |
| Chemical Properties | Green crystal |
| | 1,1,7,7-TETRAMETHYL-2,3,6,7-TETRAHYDRO-1H,5H-PYRIDO[3,2,1-IJ]QUINOLINE-9-CARBALDEHYDE Preparation Products And Raw materials |
|