|
|
| | 4-Amino-N-furan-2-ylmethyl-benzenesulfonamide Basic information |
| Product Name: | 4-Amino-N-furan-2-ylmethyl-benzenesulfonamide | | Synonyms: | OTAVA-BB BB7020361168;Benzenesulfonamide, 4-amino-N-(2-furanylmethyl)-;4-Amino-N-(furan-2-ylmethyl)benzene-1-sulfonamide;4-Amino-N-(2-furylmethyl)benzenesulfonamide;4-Amino-N-furan-2-ylmethyl-benzenesulfonamide | | CAS: | 5626-92-6 | | MF: | C11H12N2O3S | | MW: | 252.29 | | EINECS: | | | Product Categories: | | | Mol File: | 5626-92-6.mol |  |
| | 4-Amino-N-furan-2-ylmethyl-benzenesulfonamide Chemical Properties |
| Melting point | 153 °C(Solv: water (7732-18-5)) | | Boiling point | 454.5±55.0 °C(Predicted) | | density | 1.357±0.06 g/cm3(Predicted) | | pka | 11.18±0.50(Predicted) | | form | solid | | InChI | 1S/C11H12N2O3S/c12-9-3-5-11(6-4-9)17(14,15)13-8-10-2-1-7-16-10/h1-7,13H,8,12H2 | | InChIKey | GDZYTNDTKOAWSN-UHFFFAOYSA-N | | SMILES | [S](=O)(=O)(NCc2[o]ccc2)c1ccc(cc1)N | | CAS DataBase Reference | 5626-92-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 4-Amino-N-furan-2-ylmethyl-benzenesulfonamide Usage And Synthesis |
| | 4-Amino-N-furan-2-ylmethyl-benzenesulfonamide Preparation Products And Raw materials |
|