|
|
| | AKOS BBS-00007914 Basic information |
| Product Name: | AKOS BBS-00007914 | | Synonyms: | OTAVA-BB BB7016233952;AKOS A1230-8687;OTAVA-BB 7016233952;AURORA 21964;AKOS BBS-00007914;Butanoic acid, 4-(2-bromo-4-ethylphenoxy)- | | CAS: | 685853-21-8 | | MF: | C12H15BrO3 | | MW: | 287.15 | | EINECS: | | | Product Categories: | | | Mol File: | 685853-21-8.mol |  |
| | AKOS BBS-00007914 Chemical Properties |
| Boiling point | 424.9±35.0 °C(Predicted) | | density | 1.389±0.06 g/cm3(Predicted) | | pka | 4.58±0.10(Predicted) | | form | solid | | InChI | 1S/C12H15BrO3/c1-2-9-5-6-11(10(13)8-9)16-7-3-4-12(14)15/h5-6,8H,2-4,7H2,1H3,(H,14,15) | | InChIKey | WWCCSGLMIKBGCD-UHFFFAOYSA-N | | SMILES | Brc1c(ccc(c1)CC)OCCCC(=O)O |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | AKOS BBS-00007914 Usage And Synthesis |
| | AKOS BBS-00007914 Preparation Products And Raw materials |
|