|
|
| | 5-METHOXY-1H-INDAZOLE-3-CARBALDEHYDE Basic information | | Application |
| Product Name: | 5-METHOXY-1H-INDAZOLE-3-CARBALDEHYDE | | Synonyms: | 5-METHOXY-1H-INDAZOLE-3-CARBALDEHYDE;5-METHOXY-1H-INDAZOLE-3-CARBOXALDEHYDE;3-Formyl-5-methoxy-1H-indazole;5-Methoxy-1H-indazole-3-carboxyaldehyde;5-METHOXY-1H-INDAZOLE-3-CARBALDEHYDE, 95+%;5-methoxy-2H-indazole-3-carboxaldehyde;1H-Indazole-3-carboxaldehyde, 5-methoxy-;5-methoxy-1H-indazole-3-carbaldehyde - [M83559] | | CAS: | 169789-37-1 | | MF: | C9H8N2O2 | | MW: | 176.17 | | EINECS: | 604-604-1 | | Product Categories: | Indazole | | Mol File: | 169789-37-1.mol |  |
| | 5-METHOXY-1H-INDAZOLE-3-CARBALDEHYDE Chemical Properties |
| Melting point | 214-216 °C | | Boiling point | 391.7±22.0 °C(Predicted) | | density | 1.347±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 11.65±0.40(Predicted) | | Appearance | Light brown to gray Powder | | InChI | InChI=1S/C9H8N2O2/c1-13-6-2-3-8-7(4-6)9(5-12)11-10-8/h2-5H,1H3,(H,10,11) | | InChIKey | MUSWNKMMIYVNJY-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(OC)C=C2)C(C=O)=N1 |
| | 5-METHOXY-1H-INDAZOLE-3-CARBALDEHYDE Usage And Synthesis |
| Application | The molecular structure of 5-methoxy-1H-indazole-3-carboxaldehyde includes an indazole ring (containing a heterocyclic nitrogen atom) and an aldehyde group (CHO functional group). Both structural units can undergo a variety of chemical reactions, making it a powerful tool for the synthesis of other organic molecules. This substance is mainly used as an organic chemical intermediate; combined with the high chemical conversion properties of its aldehyde unit, it can be used in the synthesis of indazole-based anticancer active molecules. |
| | 5-METHOXY-1H-INDAZOLE-3-CARBALDEHYDE Preparation Products And Raw materials |
|