| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3,3'-Diethylthiatricarbocyanine perchlorate Basic information |
| Product Name: | 3,3'-Diethylthiatricarbocyanine perchlorate | | Synonyms: | benzothiazolium,3-ethyl-2-[7-(3-ethyl-2(3h)-benzothiazolylidene)-1,3,5-heptatr;3-ETHYL-2-((1E,3E,5E)-7-[3-ETHYL-1,3-BENZOTHIAZOL-2(3H)-YLIDENE]-1,3,5-HEPTATRIENYL)-1,3-BENZOTHIAZOL-3-IUM PERCHLORATE;BENZOTHIAZOLIUM, 3-ETHYL-2-[7-(3-ETHYL-2-BENZOTHIAZOLINYLIDENE)-1,3,5-HEPTATRIENYL]-, PERCHLORATE;DTTC PERCHLORATE;3 3'-DIETHYLTHIATRICARBOCYANINE &;Lasergade;3,3''-Diethyl-2,2''-thiatricarbocyanine perchlorate;3,3-DIETHYLTHIATRICARBOCYANINE PERCHLORATE, LASER GADE | | CAS: | 22268-66-2 | | MF: | C25H25ClN2O4S2 | | MW: | 517.06 | | EINECS: | | | Product Categories: | | | Mol File: | 22268-66-2.mol |  |
| | 3,3'-Diethylthiatricarbocyanine perchlorate Chemical Properties |
| Melting point | 184 °C (dec.)(lit.) | | density | 1.1561 (rough estimate) | | refractive index | 1.6100 (estimate) | | λmax | 760 nm | | InChI | 1S/C25H25N2S2.ClHO4/c1-3-26-20-14-10-12-16-22(20)28-24(26)18-8-6-5-7-9-19-25-27(4-2)21-15-11-13-17-23(21)29-25;2-1(3,4)5/h5-19H,3-4H2,1-2H3;(H,2,3,4,5)/q+1;/p-1 | | InChIKey | PZQHZVAROUTGBU-UHFFFAOYSA-M | | SMILES | [O-]Cl(=O)(=O)=O.CCN1\C(Sc2ccccc12)=C\C=C\C=C\C=C\c3sc4ccccc4[n+]3CC | | EPA Substance Registry System | Benzothiazolium, 3-ethyl-2-[7-(3-ethyl-2(3H)-benzothiazolylidene)-1,3,5-heptatrienyl]-, perchlorate (22268-66-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36-26 | | RIDADR | 2811 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ACROS
| English |
| | 3,3'-Diethylthiatricarbocyanine perchlorate Usage And Synthesis |
| Chemical Properties | green glinstening powder | | Uses | Efficient laser dye for pulsed operations |
| | 3,3'-Diethylthiatricarbocyanine perchlorate Preparation Products And Raw materials |
|