| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
|
| | (S)-(+)-Dimethindene maleate Basic information |
| Product Name: | (S)-(+)-Dimethindene maleate | | Synonyms: | N,N-DIMETHYL-3-[(1S)-1-(2-PYRIDINYL)ETHYL]-1H-INDENE-2-ETHANAMINE MALEATE;Zinc01481789;(S)-(+)-Dimethindene;1H-Indene-2-ethanamine, N,N-dimethyl-3-[(1S)-1-(2-pyridinyl)ethyl]-;(S)-(+)-Dimethindene maleate | | CAS: | 121367-05-3 | | MF: | C20H24N2 | | MW: | 292.42 | | EINECS: | | | Product Categories: | | | Mol File: | 121367-05-3.mol |  |
| | (S)-(+)-Dimethindene maleate Chemical Properties |
| Boiling point | 416.3±45.0 °C(Predicted) | | density | 1.065±0.06 g/cm3(Predicted) | | storage temp. | Desiccate at RT | | pka | 9.58±0.28(Predicted) | | InChI | InChI=1S/C20H24N2/c1-15(19-10-6-7-12-21-19)20-17(11-13-22(2)3)14-16-8-4-5-9-18(16)20/h4-10,12,15H,11,13-14H2,1-3H3/t15-/m1/s1 | | InChIKey | MVMQESMQSYOVGV-OAHLLOKOSA-N | | SMILES | C1C2=C(C=CC=C2)C([C@@H](C2=NC=CC=C2)C)=C1CCN(C)C |
| | (S)-(+)-Dimethindene maleate Usage And Synthesis |
| Uses | (S)-(+)-Dimethindene Maleate is a subtype-selective mAChR M2 antagonist and histamine H1 receptor antagonist. | | Definition | ChEBI: N,N-dimethyl-2-[3-[(1S)-1-(2-pyridinyl)ethyl]-1H-inden-2-yl]ethanamine is an indene. | | Biological Activity | Enantiomer that is a subtype-selective M 2 muscarinic receptor antagonist (pK i values are 7.08, 7.78, 6.70 and 7.00 for M 1 , M 2 , M 3 and M 4 receptors respectively). Also H 1 histamine receptor antagonist (pK i = 7.48). |
| | (S)-(+)-Dimethindene maleate Preparation Products And Raw materials |
|