| Company Name: |
Bide Pharmatech Ltd. Gold |
| Tel: |
400-164-7117 18317119277 |
| Email: |
product02@bidepharm.com |
- Biphenylene
-
-
2026-06-30
- CAS:259-79-0
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 20Tons
|
| | Biphenylene Basic information |
| | Biphenylene Chemical Properties |
| Melting point | 113-114 °C (lit.) | | Boiling point | 262℃ | | density | 1.190 | | refractive index | 1.4840 (estimate) | | Fp | 100℃ | | storage temp. | Sealed in dry,Room Temperature | | form | Needles | | color | Yellow | | InChI | InChI=1S/C12H8/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11/h1-8H | | InChIKey | IFVTZJHWGZSXFD-UHFFFAOYSA-N | | SMILES | C1C2C(=C3C=2C=CC=C3)C=CC=1 | | EPA Substance Registry System | Biphenylene (259-79-0) |
| Hazard Codes | N | | Risk Statements | 51/53 | | Safety Statements | 61-29-24/25 | | WGK Germany | 3 | | HS Code | 29029000 | | Storage Class | 11 - Combustible Solids |
| | Biphenylene Usage And Synthesis |
| Chemical Properties | YELLOW NEEDLES | | Uses |
Biphenylene can be used as an intermediate in pharmaceutical synthesis.
| | Definition | ChEBI: Biphenylene is an ortho-fused polycyclic arene and an ortho-fused tricyclic hydrocarbon. | | Synthesis |
Biphenylene is obtained by several methods; one of the best, in spite of the low yield, involved pyrolysis of dibenziodolium iodide in the presence of cuprous oxide.
| | Purification Methods | Biphenylene from yellow crystals from cyclohexane, MeOH (m 110-111o) or EtOH (m 111-112o). It sublimes in vacuo. The 2,4,7-trinitrofluorenone complex has m 154o and the picrate gives red needles m 122o from EtOH. [Beilstein 5 I 298, 5 II 530, 5 III 1935, 5 IV 2137.] |
| | Biphenylene Preparation Products And Raw materials |
|