| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1-Bromo-4-(trans-4-propylcyclohexyl)benzene Basic information |
| Product Name: | 1-Bromo-4-(trans-4-propylcyclohexyl)benzene | | Synonyms: | 1-(biphenyl-4-yl)-5-broMo-1H-indole;trans-1-BroMo-4-(4-n-propylcyclohexyl)benzene, 99%;1-Bromo-4-(trans-4-propylcyclohex-1-yl)benzene 98%;trans-1-(4-Bromophenyl)-4-propylcyclohexane;1-BROMO-4-(TRANS-4-N-PROPYLCYCLOHEXYL)BENZENE;4-PROPYL-CYCLOHEXYL-BROMO-PHENYL;1-Bromo-4-(4-Propyl-Cyclohexyl)-Benzene,3PcbrC15H21Br;4-Trans-PropylcyclohexylBenzoicAcid | | CAS: | 86579-53-5 | | MF: | C15H21Br | | MW: | 281.23 | | EINECS: | 214-254-6 | | Product Categories: | | | Mol File: | 86579-53-5.mol |  |
| | 1-Bromo-4-(trans-4-propylcyclohexyl)benzene Chemical Properties |
| Boiling point | 332.1±21.0 °C(Predicted) | | density | 1.167±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C15H21Br/c1-2-3-12-4-6-13(7-5-12)14-8-10-15(16)11-9-14/h8-13H,2-7H2,1H3/t12-,13- | | InChIKey | GMZABADCQVWQPS-JOCQHMNTSA-N | | SMILES | C1(Br)=CC=C([C@@H]2CC[C@@H](CCC)CC2)C=C1 | | CAS DataBase Reference | 86579-53-5(CAS DataBase Reference) |
| | 1-Bromo-4-(trans-4-propylcyclohexyl)benzene Usage And Synthesis |
| Uses | Intermediates of Liquid Crystals |
| | 1-Bromo-4-(trans-4-propylcyclohexyl)benzene Preparation Products And Raw materials |
|