| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
LaaJoo |
| Tel: |
021-60702684 18516024827 |
| Email: |
huang.jiayi@sinocompound.com |
|
| | Hydroquinine 9-phenanthryl ether Basic information | | Uses |
| Product Name: | Hydroquinine 9-phenanthryl ether | | Synonyms: | O-(9-PHENANTHRYL)HYDROQUININE;Hydroquinine-9-phenanthryl ether 97%;Cinchonan, 10,11-dihydro-6'-Methoxy-9-(9-phenanthrenyloxy)-, (8α,9R)-;(8α,9R)-10,11-dihydro-6'-Methoxy-9-(9-phenanthrenyloxy)-Cinchonan;(2S,4S,5R)-5-Ethyl-2-((R)-(6-methoxyquinolin-4-yl)(phenanthren-9-yloxy)methyl)quinuclidine;(8α,9R)-10,11-Dihydro-6'-methoxy-9-(9-phenanthrenyloxy)cinchonan;CAS:135096-78-5;Hydroquinine 9-phenanthryl ether | | CAS: | 135096-78-5 | | MF: | C34H34N2O2 | | MW: | 502.65 | | EINECS: | | | Product Categories: | | | Mol File: | 135096-78-5.mol |  |
| | Hydroquinine 9-phenanthryl ether Chemical Properties |
| Melting point | 120 °C (dec.)(lit.) | | Boiling point | 690.3±40.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 9+-.0.70(Predicted) | | Optical Rotation | [α]20/D +420°, c = 1 in ethanol | | BRN | 4848702 | | InChIKey | TWOVHUYOMTVDRB-BDCWUMDOSA-N | | SMILES | CC[C@H]1CN2CCC1CC2[C@H](Oc3cc4ccccc4c5ccccc35)c6ccnc7ccc(OC)cc67 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | 1544 | | WGK Germany | 3 | | F | 9 | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29392000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Hydroquinine 9-phenanthryl ether Usage And Synthesis |
| Uses | Hydrogenated quinidine is also an important pharmaceutical intermediate, but there are few reports on its preparation methods. Existing methods have low product yields and high preparation costs. Hydrogenated quinine-9-phenanthrene ether is a novel hydrogenated quinidine belonging to the quinine alkaloid class of compounds. |
| | Hydroquinine 9-phenanthryl ether Preparation Products And Raw materials |
|