| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
I-OMe-ag 538 manufacturers
|
| | I-OMe-ag 538 Basic information |
| Product Name: | I-OMe-ag 538 | | Synonyms: | TYRPHOSTIN I-OME-AG 538;I-OME-TYRPHOSTIN AG 538;ALPHA-CYANO-(3-METHOXY-4-HYDROXY-5-IODOCINNAMOYL)-(3',4'-DIHYDROXYPHENYL)KETONE;I-OMe-AG 538, α-Cyano-(3-methoxy-4-hydroxy-5-iodocinnamoyl)-(3μ,4μ-dihydroxyphenyl)ketone;α-Cyano-(3-methoxy-4-hydroxy-5-iodocinnamoyl)-(3′,4′-dihydroxyphenyl)ketone;IOMeTyrphostin AG 538,I OMe Tyrphostin AG 538;I-OMe-Tyrphostin AG 538, 10 mM in DMSO;2-(3,4-Dihydroxybenzoyl)-3-(4-hydroxy-3-iodo-5-methoxyphenyl)prop-2-enenitrile | | CAS: | 1094048-77-7 | | MF: | C17H12INO5 | | MW: | 437.19 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | I-OMe-ag 538 Chemical Properties |
| Boiling point | 605.711±55.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.815±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | -20°C | | solubility | DMSO : 50 mg/mL (114.37 mM; Need ultrasonic) | | form | solid | | pka | 7.461±0.20(predicted) | | color | Yellow to orange | | InChI | 1S/C17H12INO5/c1-24-15-6-9(5-12(18)17(15)23)4-11(8-19)16(22)10-2-3-13(20)14(21)7-10/h2-7,20-21,23H,1H3/b11-4+ | | InChIKey | HSRMHXWCTRFVHK-NYYWCZLTSA-N | | SMILES | COc1cc(cc(I)c1O)\C=C(/C#N)C(=O)c2ccc(O)c(O)c2 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | I-OMe-ag 538 Usage And Synthesis |
| Uses | I-OMe-Tyrphostin AG 538 has been used as a cell signaling inhibitor in PC-1 cell lines. It has also been used in high throughput screening assays for IGF1R inhibitors. | | Definition | ChEBI: 2-[(3,4-dihydroxyphenyl)-oxomethyl]-3-(4-hydroxy-3-iodo-5-methoxyphenyl)-2-propenenitrile is a member of chalcones. | | Biochem/physiol Actions | Insulin growth factor 1 (IGF-1) receptor protein tyrosine kinase inhibitor. |
| | I-OMe-ag 538 Preparation Products And Raw materials |
|