| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
inquiry@bocsci.com |
|
| | Uridine 5'-monophosphomorpholidate 4-morpholine-N,N'-dicyclohexylcarboxamidine salt Basic information |
| Product Name: | Uridine 5'-monophosphomorpholidate 4-morpholine-N,N'-dicyclohexylcarboxamidine salt | | Synonyms: | uridine 5'-monophosphomorpholidate;-dicyclohexylcarboxamidineSalt;-Monophosphomorpholidate4-Morpholine-N,N′Uridine 5'-monophosphomorpholidate 4-morpholine-N...;Uridine 5’-Diphosphate-13C,15N2;Uridine 5′-monophosphomorpholidate 4-morpholine-N,N′-dicyclohexylcarboxamidine;[(2R,3S,5R)-3,4-bis(acetyloxy)-5-(2,3,6,9-tetrahydro-1H-purin-9-yl)oxolan-2-yl]methyl acetate;Uridine 5'-monophosphomorpholidate 4-morpholine-N,N'-dicyclohexylcarboxamidine salt | | CAS: | 24558-91-6 | | MF: | C30H51N6O10P | | MW: | 686.74 | | EINECS: | | | Product Categories: | | | Mol File: | 24558-91-6.mol |  |
| | Uridine 5'-monophosphomorpholidate 4-morpholine-N,N'-dicyclohexylcarboxamidine salt Chemical Properties |
| storage temp. | -20°C | | solubility | soluble in Dichloromethane | | form | Solid | | color | Off-White | | biological source | synthetic (organic) | | InChIKey | RUAYLFCHPJYFJL-YBBCWCDONA-N | | SMILES | C(/N1CCOCC1)(\NC1CCCCC1)=N/C1CCCCC1.O[C@@H]1[C@@H]([C@@H](COP(N2CCOCC2)(O)=O)O[C@H]1N1C=CC(=O)NC1=O)O |&1:22,23,24,37,r| |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Uridine 5'-monophosphomorpholidate 4-morpholine-N,N'-dicyclohexylcarboxamidine salt Usage And Synthesis |
| Uses | Uridine 5′-Monophosphomorpholidate 4-Morpholine-N,N′-dicyclohexylcarboxamidine Salt is used in the synthesis of several organic compounds including that of Uridine 5''-(5-thio-α-D-glucopyranosyl pyrophosphate) which is a potent activator of rat liver glycogen synthetase. It was used as a reagent in glycoprotein labelling with click chemistry and carbohydrate detection. Also used in the preparation of UDP-3-O[R-3-Hydroxymyristoyl]-N-acetylglucosamine Tris Salt (U250525). | | Biological Activity | Uridine5μ-monophosphomorpholidate 4-morpholine-N,Nμ-dicyclohexylcarboxamidine salt, also known as UMP-morpholidate, is used as a reactant in the synthesis of uridine5μ-(2,3,4-tri-O-acetyl-6-S-acetyl-6-thio-α-d-galactopyranosyldiphosphate). UMP-morpholidate serves as a key reactant in the Khorana-Moffatt procedure for synthesizing uridine diphosphate (UDP)-sugar nucleotides.Uridine 5μ-monophosphomorpholidate 4-morpholine-N,Nμ-dicyclohexylcarboxamidine salt can be used for the synthesis of UDP-azido-GalNAc (uridine diphosphate N-azido acetylgalactosamine). |
| | Uridine 5'-monophosphomorpholidate 4-morpholine-N,N'-dicyclohexylcarboxamidine salt Preparation Products And Raw materials |
|