| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
UDP-alpha-D-galactose disodium salt manufacturers
- UDP-Galactose
-
-
2022-12-16
- CAS:137868-52-1
- Purity: 95
- Supply Ability: 1000000
- UDP-Gal.2Na
-
-
2020-03-26
- CAS:137868-52-1
- Min. Order: 10mg
- Purity: 97%HPLC
|
| | UDP-alpha-D-galactose disodium salt Basic information |
| Product Name: | UDP-alpha-D-galactose disodium salt | | Synonyms: | UDPG DISODIUM SALT;UDP-GALNAC, NA2;UDP-GAL DISODIUM SALT;UDP-GAL, NA2;UDP-α-D-Galactose, Disodium Salt - CAS 137868-52-1 - Calbiochem;Uridine Impurity 8 (UDP-Galactose Disodium Salt);UDP-GALACTOSE DISODIUM SALT;URIDINE-DIPHOSPHATE-GALACTOSE DISODIUM SALT | | CAS: | 137868-52-1 | | MF: | C15H25N2NaO17P2 | | MW: | 590.3 | | EINECS: | | | Product Categories: | | | Mol File: | 137868-52-1.mol |  |
| | UDP-alpha-D-galactose disodium salt Chemical Properties |
| Fp | 27 °C | | storage temp. | -20°C | | solubility | H2O: 50 mg/mL, clear, colorless | | form | White solid | | color | White to Off-White | | biological source | bovine milk rabbit muscle yeast | | Water Solubility | water: 100mg/mL | | BRN | 5374254 | | Stability: | Hygroscopic | | InChIKey | QSCAYUHBYHAJER-BGHHQIFUNA-N | | SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP(O)(=O)O[C@@H]2[C@@H]([C@@H](O)[C@@H](O)[C@@H](CO)O2)O)O[C@H]1N1C=CC(=O)NC1=O)O.[NaH] |&1:1,2,3,14,15,16,18,20,26,r| |
| Hazard Codes | Xi,R | | Risk Statements | 36/37/38-10 | | Safety Statements | 26-16 | | RIDADR | UN 2910 7 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids |
| | UDP-alpha-D-galactose disodium salt Usage And Synthesis |
| Description | Udp-alpha-d-galactose disodium salt is an endogenous nucleotide sugar. The compound is a donor substrate for galactosyltransferases employed in the biosynthesis of galactose-containing oligosaccharides. | | Chemical Properties | White powder | | Uses | Gal transferase substrate | | Uses | UDP-D-galactose disodium salt is a uridine (U829910) derivative used in the synthesis of 5-CF3 UDP non-natural sugar nucleotides which are micromolar inhibitors of galactosyltransferases. | | General Description | Uridine 5′-diphospho-α-D-galactose/UDP-Gal is a nucleotide sugar. | | Biochem/physiol Actions | Uridine 5′-diphospho-α-D-galactose/UDP-Gal can block BALB/3T12 cell development. In mammals, it is very essential for glycoconjugate biosynthesis. |
| | UDP-alpha-D-galactose disodium salt Preparation Products And Raw materials |
|