|
|
| | 2,4-Diphenyl-1,3-thiazole-5-carboxylic acid Basic information |
| Product Name: | 2,4-Diphenyl-1,3-thiazole-5-carboxylic acid | | Synonyms: | 2,4-DIPHENYLTHIAZOLE-5-CARBOXYLIC ACID;2,4-Diphenyl-1,3-thiazole-5-carboxylic acid 97%;2,4-DIPHENYL-1,3-THIAZOLE-5-CARBOXYLIC;5-Thiazolecarboxylicacid, 2,4-diphenyl-;diphenyl-1,3-thiazole-5-carboxylic acid;2,4-Diphenyl-1,3-thiazole-5-carboxylic acid | | CAS: | 502935-47-9 | | MF: | C16H11NO2S | | MW: | 281.33 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 502935-47-9.mol |  |
| | 2,4-Diphenyl-1,3-thiazole-5-carboxylic acid Chemical Properties |
| Melting point | 212 °C | | storage temp. | Refrigerator, Under inert atmosphere | | solubility | DMSO (Slightly, Sonicated), Methanol (Very Slightly, Heated, Sonicated) | | form | Solid | | color | Pale Yellow to Light Yellow | | InChI | 1S/C16H11NO2S/c18-16(19)14-13(11-7-3-1-4-8-11)17-15(20-14)12-9-5-2-6-10-12/h1-10H,(H,18,19) | | InChIKey | KMOCHRNIGWCEJV-UHFFFAOYSA-N | | SMILES | OC(=O)c1sc(nc1-c2ccccc2)-c3ccccc3 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2,4-Diphenyl-1,3-thiazole-5-carboxylic acid Usage And Synthesis |
| Uses | 2,4-diphenylthiazole-5-carboxylic acid is used in preparation of FASN inhibitors useful for treatment of cancer and other diseases. |
| | 2,4-Diphenyl-1,3-thiazole-5-carboxylic acid Preparation Products And Raw materials |
|