| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-Bromobutyryl chloride Basic information |
| | 4-Bromobutyryl chloride Chemical Properties |
| Boiling point | 101 °C37 mm Hg(lit.) | | density | 1.60 g/mL at 20 °C | | refractive index | n20/D 1.492(lit.) | | Fp | 91 °C | | storage temp. | Inert atmosphere,Room Temperature | | form | Liquid | | color | Clear colorless to slightly yellow or light pink | | Water Solubility | Miscible with organic solvents. Immiscible with water. | | Sensitive | Moisture Sensitive | | BRN | 1743026 | | InChI | InChI=1S/C4H6BrClO/c5-3-1-2-4(6)7/h1-3H2 | | InChIKey | LRTRXDSAJLSRTG-UHFFFAOYSA-N | | SMILES | C(Cl)(=O)CCCBr | | CAS DataBase Reference | 927-58-2(CAS DataBase Reference) | | NIST Chemistry Reference | Butanoyl chloride, 4-bromo-(927-58-2) | | EPA Substance Registry System | Butanoyl chloride, 4-bromo- (927-58-2) |
| Hazard Codes | C | | Risk Statements | 14-34-37 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | F | 3-8-10 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29159000 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B
STOT SE 3 |
| | 4-Bromobutyryl chloride Usage And Synthesis |
| Chemical Properties | clear colorless to slightly yellow or | | Uses | 4-Bromobutyryl chloride is used as a precursor for the synthesis of carolic acid by reacting with ethoxymagnesiomalonic ester. It is widely utilized as an intermediate in organic synthesis and pharmaceuticals. | | reaction suitability | reagent type: cross-linking reagent |
| | 4-Bromobutyryl chloride Preparation Products And Raw materials |
|