| Company Name: |
DebyeTec.com Inc. |
| Tel: |
18086626237 18086626237 |
| Email: |
2693528373@qq.com |
Dotinurad Impurity 5 manufacturers
- Dotinurad Impurity
-
-
2025-12-16
- CAS:
- Min. Order: 10mg
- Purity: 99%+ HPLC
- Supply Ability: 1000
|
| | Dotinurad Impurity 5 Basic information |
| Product Name: | Dotinurad Impurity 5 | | Synonyms: | Dotinurad Impurity 5;Methanone, (3,5-dichloro-4-methoxyphenyl)(1-oxido-3(2H)-benzothiazolyl)-;(3,5-Dichloro-4-methoxyphenyl)(1-oxido-3(2H)-benzothiazolyl)methanone;Dotinurad Impurity;Dotinurad Impurity 36;dibenzo[d,i][1,6,3,8]dithiadiazecine-7,14(6H,13H)-diylbis((3,5-dichloro-4-methoxyphenyl)methanone);(3,5-dichloro-4-methoxyphenyl)(1-oxidobenzo[d]thiazol-3(2H)-yl)methanone | | CAS: | 1285573-47-8 | | MF: | C15H11Cl2NO3S | | MW: | 356.22 | | EINECS: | | | Product Categories: | | | Mol File: | 1285573-47-8.mol |  |
| | Dotinurad Impurity 5 Chemical Properties |
| Boiling point | 596.8±50.0 °C(Predicted) | | density | 1.60±0.1 g/cm3(Predicted) | | pka | -3.06±0.20(Predicted) | | InChI | InChI=1S/C15H11Cl2NO3S/c1-21-14-10(16)6-9(7-11(14)17)15(19)18-8-22(20)13-5-3-2-4-12(13)18/h2-7H,8H2,1H3 | | InChIKey | NSKAUABFSJSUHS-UHFFFAOYSA-N | | SMILES | C(C1=CC(Cl)=C(OC)C(Cl)=C1)(N1C2=CC=CC=C2S(=O)C1)=O |
| | Dotinurad Impurity 5 Usage And Synthesis |
| | Dotinurad Impurity 5 Preparation Products And Raw materials |
|