| Company Name: |
DebyeTec.com Inc. |
| Tel: |
18086626237 18086626237 |
| Email: |
2693528373@qq.com |
Dotinurad Impurity 2 manufacturers
|
| | Dotinurad Impurity 2 Basic information |
| Product Name: | Dotinurad Impurity 2 | | Synonyms: | Dotinurad Impurity 2;Methanone, (3,5-dichloro-4-hydroxyphenyl)(1-oxido-3(2H)-benzothiazolyl)-;3-(3,5-dichloro-4-hydroxybenzoyl)-1-oxo-2,3-dihydro-1,3-benzothiazole;(3,5-Dichloro-4-hydroxyphenyl)(1-oxido-3(2H)-benzothiazolyl)methanone;(5,5,12,12-tetraoxidodibenzo[d,i][1,6,3,8]dithiadiazecine-7,14(6H,13H)-diyl)bis((3,5-dichloro-4-hydroxyphenyl)methanone);RMA-869;(3,5-dichloro-4-hydroxyphenyl)(1-oxidobenzo[d]thiazol-3(2H)-yl)methanone;Dortenorel impurities | | CAS: | 1285572-55-5 | | MF: | C14H9Cl2NO3S | | MW: | 342.2 | | EINECS: | | | Product Categories: | LFQ | | Mol File: | 1285572-55-5.mol |  |
| | Dotinurad Impurity 2 Chemical Properties |
| Boiling point | 592.3±50.0 °C(Predicted) | | density | 1.73±0.1 g/cm3(Predicted) | | pka | 4.82±0.25(Predicted) | | InChI | InChI=1S/C14H9Cl2NO3S/c15-9-5-8(6-10(16)13(9)18)14(19)17-7-21(20)12-4-2-1-3-11(12)17/h1-6,18H,7H2 | | InChIKey | LQNDVNGYLFJLGJ-UHFFFAOYSA-N | | SMILES | C(C1=CC(Cl)=C(O)C(Cl)=C1)(N1C2=CC=CC=C2S(=O)C1)=O |
| | Dotinurad Impurity 2 Usage And Synthesis |
| | Dotinurad Impurity 2 Preparation Products And Raw materials |
|