| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (S)-Mandelamide Basic information |
| Product Name: | (S)-Mandelamide | | Synonyms: | (S)-(+)-2-Hydroxy-2-phenylacetamide;(S)-(+)-Mandelamide >=97%;(S)-a-Hydroxybenzeneacetamide;Benzeneacetamide, α-hydroxy-, (αS)-;(s)-mandeloylamine;BENZENEACETAMIDE, A-HYDROXY-,(AS)-;Mirabegron Impurity 64;(S)-(+)-Mandelamide | | CAS: | 24008-63-7 | | MF: | C8H9NO2 | | MW: | 151.16 | | EINECS: | | | Product Categories: | | | Mol File: | 24008-63-7.mol |  |
| | (S)-Mandelamide Chemical Properties |
| form | crystals | | Optical Rotation | [α]/D +56±2° | | BRN | 5251737 | | InChI | InChI=1/C8H9NO2/c9-8(11)7(10)6-4-2-1-3-5-6/h1-5,7,10H,(H2,9,11)/t7-/s3 | | InChIKey | MAGPZHKLEZXLNU-KPOCXSGKNA-N | | SMILES | C(N)(=O)[C@@H](O)C1=CC=CC=C1 |&1:3,r| |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (S)-Mandelamide Usage And Synthesis |
| Uses | Produced by the conversion of (S)-mandelonitrile by the arylacetonitrilase of Pseudomonas fluorescens EBC191 | | Definition | ChEBI: (S)-mandelamide is a mandelamide in which the stereocentre at position 2 has S-configuration It is an enantiomer of a (R)-mandelamide. |
| | (S)-Mandelamide Preparation Products And Raw materials |
|