- Tetrachloropropene
-
- $21.00
-
2024-01-08
- CAS:10436-39-2
- Min. Order: 1kg
- Purity: 99.96%
- Supply Ability: 500ton
- Tetrachloropropene
-
- $100.00
-
2023-09-05
- CAS:10436-39-2
- Min. Order: 1drum
- Purity: 99
- Supply Ability: 5000
|
| | Tetrachloropropene Basic information |
| Product Name: | Tetrachloropropene | | Synonyms: | 1,1,2,3-tetrachloro-1-propen;1,1,2,3-tetrachloro-1-propene;1,1,2,3-tetrachloro-propen;2,3,3-trichloroallyl chloride;Tetrachloropropene;1,1,2,3-tetrachloro-propen，98%;1-Propene, 1,1,2,3-tetrachloro-;1,1,2,3-Tetrachloropropene | | CAS: | 10436-39-2 | | MF: | C3H2Cl4 | | MW: | 179.86 | | EINECS: | 233-920-8 | | Product Categories: | | | Mol File: | 10436-39-2.mol |  |
| | Tetrachloropropene Chemical Properties |
| Boiling point | 141.38°C (rough estimate) | | density | 1.5500 | | refractive index | 1.5121 (estimate) | | storage temp. | Refrigerator | | solubility | Chloroform, Methanol (Slightly) | | form | Oil | | color | Colourless | | InChI | InChI=1S/C3H2Cl4/c4-1-2(5)3(6)7/h1H2 | | InChIKey | UMGQVBVEWTXECF-UHFFFAOYSA-N | | SMILES | C(/Cl)(\Cl)=C(/Cl)\CCl | | EPA Substance Registry System | 1,1,2,3-Tetrachloropropene (10436-39-2) |
| | Tetrachloropropene Usage And Synthesis |
| Chemical Properties | This product is a colorless oily liquid with a temperature of 167.1°C, a relative density of 1.5409, a vapor pressure of 4.676 kPa at 74.8°C, and is soluble in organic solvents such as chloroform and carbon tetrachloride. | | Uses | 1,1,2,3-Tetrachloropropene is used in producing 2,3,3,3-Tetrachloropropene. 2,3,3,3-Tetrachloropropene may be useful as heat transfer compns., aerosol propellants, foaming agents, blowing agents, solvents, cleaning agents, carrier fluids, displacement drying agents, buffing abrasion agents, polymn. |
| | Tetrachloropropene Preparation Products And Raw materials |
|