|
|
| | 2-(4-chloro-3-sulphamoylbenzoyl)benzoic acid Basic information |
| Product Name: | 2-(4-chloro-3-sulphamoylbenzoyl)benzoic acid | | Synonyms: | Chlorthalidone Related Compound A (10 mg) (4'-Chloro-3'-sulfamoyl-2-benzophenone Carboxylic Acid);Chlorthalidone Related CoMpound A;2-[3-(AMinosulfonyl)-4-chlorobenzoyl]-benzonic Acid;2-(4-chloro-3-sulfaMoylbenzoyl)benzoic acid;4′-Chloro-3′-sulfamoyl-2-benzophenone-2-carboxylic acid;Benzoic acid,2-[3-(aminosulfonyl)-4-chlorobenzoyl]-;2-(4-chloro-3-sulphamoylbenzoyl)benzoic acid;2-[3-(Aminosulfonyl)-4-chlorobenzoyl]benzoic acid | | CAS: | 5270-74-6 | | MF: | C14H10ClNO5S | | MW: | 339.75 | | EINECS: | 226-089-8 | | Product Categories: | Aromatics, Sulfur & Selenium Compounds | | Mol File: | 5270-74-6.mol |  |
| | 2-(4-chloro-3-sulphamoylbenzoyl)benzoic acid Chemical Properties |
| Melting point | >207°C (dec.) | | Boiling point | 638.6±65.0 °C(Predicted) | | density | 1.537±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.20±0.36(Predicted) | | color | White to Pale Beige | | Stability: | Hygroscopic | | Major Application | pharmaceutical
pharmaceutical small molecule | | InChI | 1S/C14H10ClNO5S/c15-11-6-5-8(7-12(11)22(16,20)21)13(17)9-3-1-2-4-10(9)14(18)19/h1-7H,(H,18,19)(H2,16,20,21) | | InChIKey | UKRADWWBRBBJLZ-UHFFFAOYSA-N | | SMILES | [S](=O)(=O)(N)c1c(ccc(c1)C(=O)c2c(cccc2)C(=O)O)Cl |
| WGK Germany | 3 | | HS Code | 2935909550 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-(4-chloro-3-sulphamoylbenzoyl)benzoic acid Usage And Synthesis |
| Uses | 2-[3-(Aminosulfonyl)-4-chlorobenzoyl]-benzonic Acid is a potential metabolite of Chlorthalidone. |
| | 2-(4-chloro-3-sulphamoylbenzoyl)benzoic acid Preparation Products And Raw materials |
|