|
|
| | ethyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate Basic information |
| Product Name: | ethyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate | | Synonyms: | 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoic acid ethyl ester;ethyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate;Benzenepropanoic acid, 3,5-bis(1,1-dimethylethyl)-4-hydroxy-, ethyl ester;ethyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propanoate | | CAS: | 36294-24-3 | | MF: | C19H30O3 | | MW: | 306.44 | | EINECS: | 252-953-9 | | Product Categories: | Organics | | Mol File: | 36294-24-3.mol |  |
| | ethyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate Chemical Properties |
| Melting point | 50-51 °C(Solv: ethanol (64-17-5); water (7732-18-5)) | | Boiling point | 357.6±37.0 °C(Predicted) | | density | 0.997±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 12.35±0.40(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | 1S/C19H30O3/c1-8-22-16(20)10-9-13-11-14(18(2,3)4)17(21)15(12-13)19(5,6)7/h11-12,21H,8-10H2,1-7H3 | | InChIKey | ZCWSUZJGZZFSHM-UHFFFAOYSA-N | | SMILES | O(CC)C(=O)CCc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C | | EPA Substance Registry System | Ethyl 3,5-di-tert-butyl-4-hydroxyhydrocinnamate (36294-24-3) |
| WGK Germany | WGK 2 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 2 |
| | ethyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate Usage And Synthesis |
| | ethyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate Preparation Products And Raw materials |
|