| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | (9Z,12Z)-octadeca-9,12-dienoic acid, monoester with glycerol Basic information |
| | (9Z,12Z)-octadeca-9,12-dienoic acid, monoester with glycerol Chemical Properties |
| Melting point | 14-15 °C | | storage temp. | 2-8°C | | Major Application | pharmaceutical (small molecule) | | Cosmetics Ingredients Functions | SKIN CONDITIONING
SURFACTANT - EMULSIFYING
SKIN CONDITIONING - EMOLLIENT | | InChI | 1S/C21H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h6-7,9-10,20,22-23H,2-5,8,11-19H2,1H3/b7-6-,10-9- | | InChIKey | WECGLUPZRHILCT-HZJYTTRNSA-N | | SMILES | O(CC(O)CO)C(=O)CCCCCCC\C=C/C\C=C/CCCCC | | LogP | 6.273 (est) |
| WGK Germany | WGK 1 | | HS Code | 2916151000 | | Storage Class | 10 - Combustible liquids |
| | (9Z,12Z)-octadeca-9,12-dienoic acid, monoester with glycerol Usage And Synthesis |
| Uses | Glyceryl Linoleate is used in the synthesis of controlled release systems for drug delivery. Also in the preparation of a self-microemulsifying drug delivery system for the enhancement of oral drug bioavailability. This item is a mixture of esters at the 1 and 2 positions. | | Definition | ChEBI: 1-monolinolein is a 1-monoglyceride that has octadecadienoyl (linoleoyl) as the acyl group. It has a role as a plant metabolite and an antiviral agent. It is functionally related to a linoleic acid. |
| | (9Z,12Z)-octadeca-9,12-dienoic acid, monoester with glycerol Preparation Products And Raw materials |
|