| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | 1-[3,5-bis(phenylmethoxy)phenyl]-2-bromoethan-1-one Basic information |
| Product Name: | 1-[3,5-bis(phenylmethoxy)phenyl]-2-bromoethan-1-one | | Synonyms: | 1-[3,5-Bis(phenylmethoxy)phenyl]-2-bromoethanone;1-[3,5-bis(phenylmethoxy)phenyl]-2-bromoethan-1-one;3',5'-Bis(benzyloxy)-2-broMo-acetophenone;2-bromo-1-[3,5-bis(phenylmethoxy)phenyl]ethanone;Terbutaline-003;Terbutaline Impurity 7;Terbutaline Impurity 3;Ethanone, 1-[3,5-bis(phenylmethoxy)phenyl]-2-bromo- | | CAS: | 28924-18-7 | | MF: | C22H19BrO3 | | MW: | 411.29 | | EINECS: | 249-314-1 | | Product Categories: | Aromatics | | Mol File: | 28924-18-7.mol | ![1-[3,5-bis(phenylmethoxy)phenyl]-2-bromoethan-1-one Structure](CAS/GIF/28924-18-7.gif) |
| | 1-[3,5-bis(phenylmethoxy)phenyl]-2-bromoethan-1-one Chemical Properties |
| Melting point | 84-86°C | | Boiling point | 523.8±45.0 °C(Predicted) | | density | 1.354±0.06 g/cm3(Predicted) | | solubility | soluble in Dichloromethane, Ethyl Acetate, Methanol | | form | Solid | | color | White | | InChI | InChI=1S/C22H19BrO3/c23-14-22(24)19-11-20(25-15-17-7-3-1-4-8-17)13-21(12-19)26-16-18-9-5-2-6-10-18/h1-13H,14-16H2 | | InChIKey | JIQMOQSQAVBFLO-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC(OCC2=CC=CC=C2)=CC(OCC2=CC=CC=C2)=C1)CBr |
| | 1-[3,5-bis(phenylmethoxy)phenyl]-2-bromoethan-1-one Usage And Synthesis |
| Chemical Properties | White Solid |
| | 1-[3,5-bis(phenylmethoxy)phenyl]-2-bromoethan-1-one Preparation Products And Raw materials |
|