|
|
| | 2-methoxy-5-nitrobenzonitrile Basic information |
| | 2-methoxy-5-nitrobenzonitrile Chemical Properties |
| Melting point | 126 °C | | Boiling point | 339.0±27.0 °C(Predicted) | | density | 1.32±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C8H6N2O3/c1-13-8-3-2-7(10(11)12)4-6(8)5-9/h2-4H,1H3 | | InChIKey | LTYIIDMVVUWOGP-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC([N+]([O-])=O)=CC=C1OC |
| | 2-methoxy-5-nitrobenzonitrile Usage And Synthesis |
| Synthesis Reference(s) | Journal of the American Chemical Society, 88, p. 2884, 1966 DOI: 10.1021/ja00964a070 |
| | 2-methoxy-5-nitrobenzonitrile Preparation Products And Raw materials |
|