|
|
| | 3-Cyano-4-hydroxybenzoic acid Basic information |
| Product Name: | 3-Cyano-4-hydroxybenzoic acid | | Synonyms: | 3-Cyano-4-hydroxybenzoic acid;5-Carboxy-2-hydroxybenzonitrile, 4-Carboxy-2-cyanophenol;3-Cyano-4-hydroxybenzoic acid 95+%;Benzoic acid, 3-cyano-4-hydroxy-;3-Cyano-4-hydroxybenzoicaci;RP112533 | | CAS: | 70829-28-6 | | MF: | C8H5NO3 | | MW: | 163.13 | | EINECS: | | | Product Categories: | | | Mol File: | 70829-28-6.mol |  |
| | 3-Cyano-4-hydroxybenzoic acid Chemical Properties |
| Melting point | 265-266 °C | | Boiling point | 392.4±37.0 °C(Predicted) | | density | 1.50±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 4.01±0.10(Predicted) | | color | Off-white to faint yellow | | InChI | InChI=1S/C8H5NO3/c9-4-6-3-5(8(11)12)1-2-7(6)10/h1-3,10H,(H,11,12) | | InChIKey | KUCSFDLSLAVLBY-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(O)C(C#N)=C1 |
| | 3-Cyano-4-hydroxybenzoic acid Usage And Synthesis |
| Synthesis | General procedure for the synthesis of 3-carbonitrile-4-hydroxybenzoic acid from compound (CAS: 773837-37-9) and compound (CAS: 1131588-12-9): the product of Example 44 Step C (0.22 g, 0.72 mmol), NaCN (0.04 g, 0.8 mmol), and CuCN (0.07 g, 0.8 mmol) in anhydrous DMF (2 mL) was stirred at 110 °C for 2 h in a nitrogen atmosphere. Upon completion of the reaction, the mixture was evaporated to dryness under vacuum and the residue was suspended in water (10 mL) and the pH was adjusted with 1 M NaOH solution to about 10. The insoluble material was removed by filtration and the filtrate was acidified with dilute HCl to pH ~3. The product was extracted with dichloromethane (2 x 20 mL). The organic phases were combined and dried with anhydrous MgSO4, and the filtrate was filtered and evaporated to dryness under reduced pressure to give 3-carbonitrile-4-hydroxybenzoic acid (0.1 g, 67% yield) as a brown solid.1H-NMR (CDCl3) δ: 1.06-1.14 (m, 3H), 1.85-1.97 (m, 2H), 4.1-4.18 (m, 2H), 7.02 (d , 1H, J = 9 Hz), 8.24 (dd, 1H, J = 3, 9 Hz), 8.31 (d, 1H, J = 3 Hz). | | References | [1] Patent: WO2010/42998, 2010, A1. Location in patent: Page/Page column 109 |
| | 3-Cyano-4-hydroxybenzoic acid Preparation Products And Raw materials |
|