| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
2-Bromo-2',6'-diisopropoxy-1,1'-biphenyl manufacturers
|
| | 2-Bromo-2',6'-diisopropoxy-1,1'-biphenyl Basic information |
| Product Name: | 2-Bromo-2',6'-diisopropoxy-1,1'-biphenyl | | Synonyms: | 1,1'-Biphenyl, 2'-bromo-2,6-bis(1-methylethoxy)-;-diisopropoxy-1，1′;2-Bromo-2′,6′-diisopropoxy-1,1′-biphenyl, CAS 870703-70-1;2-Bromo-2',6'-diisopropoxy-1,1'-biphenyl | | CAS: | 870703-70-1 | | MF: | C18H21BrO2 | | MW: | 349.26 | | EINECS: | | | Product Categories: | | | Mol File: | 870703-70-1.mol |  |
| | 2-Bromo-2',6'-diisopropoxy-1,1'-biphenyl Chemical Properties |
| Boiling point | 140 °C/0.2 mmHg | | density | 1.231 g/mL at 25 °C | | refractive index | n20/D 1.562 | | Fp | 110 °C | | InChI | 1S/C18H21BrO2/c1-12(2)20-16-10-7-11-17(21-13(3)4)18(16)14-8-5-6-9-15(14)19/h5-13H,1-4H3 | | InChIKey | SHUUMGHTDLOJAU-UHFFFAOYSA-N | | SMILES | CC(C)Oc1cccc(OC(C)C)c1-c2ccccc2Br |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 |
| | 2-Bromo-2',6'-diisopropoxy-1,1'-biphenyl Usage And Synthesis |
| | 2-Bromo-2',6'-diisopropoxy-1,1'-biphenyl Preparation Products And Raw materials |
|