| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | (6-Bromohexyl)ferrocene Basic information |
| | (6-Bromohexyl)ferrocene Chemical Properties |
| storage temp. | 2-8°C, stored under nitrogen | | form | solid | | Appearance | Yellow to brown Liquid | | InChI | 1S/C11H16Br.C5H5.Fe/c12-10-6-2-1-3-7-11-8-4-5-9-11;1-2-4-5-3-1;/h4-5,8-9H,1-3,6-7,10H2;1-5H; | | InChIKey | LNVDAJXWPKYLFP-UHFFFAOYSA-N | | SMILES | [Fe].[CH]1[CH][CH][CH][CH]1.BrCCCCCC[C]2[CH][CH][CH][CH]2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (6-Bromohexyl)ferrocene Usage And Synthesis |
| Uses | A ferrocene building block. | | reaction suitability | core: iron reagent type: catalyst |
| | (6-Bromohexyl)ferrocene Preparation Products And Raw materials |
|