| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1-(4-BROMOPHENYL)-3-PHENYLPYRAZOLE-4-PR& Basic information |
| | 1-(4-BROMOPHENYL)-3-PHENYLPYRAZOLE-4-PR& Chemical Properties |
| Melting point | 143-147 °C | | form | solid | | InChI | 1S/C18H15BrN2O2/c19-15-7-9-16(10-8-15)21-12-14(6-11-17(22)23)18(20-21)13-4-2-1-3-5-13/h1-5,7-10,12H,6,11H2,(H,22,23) | | InChIKey | LAQITLKSECQDHZ-UHFFFAOYSA-N | | SMILES | OC(=O)CCc1cn(nc1-c2ccccc2)-c3ccc(Br)cc3 |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | 1-(4-BROMOPHENYL)-3-PHENYLPYRAZOLE-4-PR& Usage And Synthesis |
| | 1-(4-BROMOPHENYL)-3-PHENYLPYRAZOLE-4-PR& Preparation Products And Raw materials |
|