Benzoic acid, 2-hexyl-4,6-dihydroxy-, methyl ester manufacturers
|
| | Benzoic acid, 2-hexyl-4,6-dihydroxy-, methyl ester Basic information |
| Product Name: | Benzoic acid, 2-hexyl-4,6-dihydroxy-, methyl ester | | Synonyms: | Benzoic acid, 2-hexyl-4,6-dihydroxy-, methyl ester;Methyl 2-hexyl-4,6-dihydroxybenzoate;Methyl 2,4-dihydroxy-6-Hexylbenzoate;2,4-dihydroxy-6-n-hexylbenzoic acid, methyl ester;2,4-Dihydroxy-6-hexyl-benzoic acid methyl ester | | CAS: | 102342-63-2 | | MF: | C14H20O4 | | MW: | 252.31 | | EINECS: | 208-028-7 | | Product Categories: | | | Mol File: | 102342-63-2.mol |  |
| | Benzoic acid, 2-hexyl-4,6-dihydroxy-, methyl ester Chemical Properties |
| Boiling point | 420.4±30.0 °C(Predicted) | | density | 1.131±0.06 g/cm3(Predicted) | | pka | 8.49±0.24(Predicted) | | InChI | InChI=1S/C14H20O4/c1-3-4-5-6-7-10-8-11(15)9-12(16)13(10)14(17)18-2/h8-9,15-16H,3-7H2,1-2H3 | | InChIKey | ROSRLTQYJHJXIK-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=C(O)C=C(O)C=C1CCCCCC |
| | Benzoic acid, 2-hexyl-4,6-dihydroxy-, methyl ester Usage And Synthesis |
| Chemical Properties | Red-brown crystalline powder | | Uses | Benzoic acid, 2-hexyl-4,6-dihydroxy-, methyl ester, an important organic intermediate, can be used to synthesize organics such as 5-hexylbenzene-1,3-diol, 2-hexyl-4-hydroxy-6-methoxybenzoic acid, and so on. | | Preparation | Using heptanone as the raw material, sodium hydroxide was added to initiate the reaction. TosOH, CHz(COOCH3)2, and NaOMe-MeOH were subsequently added for further reaction. Finally, Br2-DMF was added at 0 °C and then heated to 70-80 °C. After 24 hours of reaction, Benzoic acid, 2-hexyl-4,6-dihydroxy-, methyl ester could be obtained. | | Solubility in organics | Very soluble in N,N-Dimethylformamide,Soluble in methanol,Sparingly soluble inglacial acetic acid, Very slightly soluble inchloroform, Practically insoluble in water. |
| | Benzoic acid, 2-hexyl-4,6-dihydroxy-, methyl ester Preparation Products And Raw materials |
|