- BocNH-PEG1-CH2COOH
-
- $57.00 / 1g
-
2026-01-10
- CAS:142929-49-5
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 500kg
- Boc-NH-PEG1-CH2COOH
-
- $0.00 / 100mg
-
2026-01-05
- CAS:142929-49-5
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | Acetic acid, [2-[[(1,1-dimethylethoxy)carbonyl]amino]ethoxy]- (9CI) Basic information |
| Product Name: | Acetic acid, [2-[[(1,1-dimethylethoxy)carbonyl]amino]ethoxy]- (9CI) | | Synonyms: | Acetic acid, [2-[[(1,1-dimethylethoxy)carbonyl]amino]ethoxy]- (9CI);5-(t-Butyloxycarbonyl-amino)-3-oxapentanoic acid, [2-(Boc-amino)ethoxy]acetic acid, dicyclohexylamine;Boc-O1Pen-OH*DCHA;5-[[(tert-Butoxy)carbonyl]amino]-3-oxapentanoic acid;(2-Boc-Aminoethoxy)acetic acid;2-(2-((tert-Butoxycarbonyl)aMino)ethoxy)acetic acid;5-(t-Butyloxycarbonyl-aMino)-3-oxapentanoic acid;t-Boc-N-amido-PEG1-CH2CO2H | | CAS: | 142929-49-5 | | MF: | C9H17NO5 | | MW: | 219.24 | | EINECS: | | | Product Categories: | N-BOC | | Mol File: | 142929-49-5.mol | ![Acetic acid, [2-[[(1,1-dimethylethoxy)carbonyl]amino]ethoxy]- (9CI) Structure](CAS/GIF/142929-49-5.gif) |
| | Acetic acid, [2-[[(1,1-dimethylethoxy)carbonyl]amino]ethoxy]- (9CI) Chemical Properties |
| Boiling point | 391.2±22.0 °C(Predicted) | | density | 1.151±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | form | <44.2°C Solid,>67.5°C Liquid | | pka | 3.44±0.10(Predicted) | | color | Colorless to light yellow | | InChI | InChI=1S/C9H17NO5/c1-9(2,3)15-8(13)10-4-5-14-6-7(11)12/h4-6H2,1-3H3,(H,10,13)(H,11,12) | | InChIKey | UPBQMAHYLWJGDW-UHFFFAOYSA-N | | SMILES | C(O)(=O)COCCNC(OC(C)(C)C)=O |
| WGK Germany | WGK 3 | | HS Code | 9999999999 | | Storage Class | 10 - Combustible liquids |
| | Acetic acid, [2-[[(1,1-dimethylethoxy)carbonyl]amino]ethoxy]- (9CI) Usage And Synthesis |
| Description | t-Boc-N-amido-PEG1-CH2CO2H is a PEG linker containing a terminal carboxylic acid and Boc-protected amino group. The hydrophilic PEG spacer increases solubility in aqueous media. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The Boc group can be deprotected under mild acidic conditions to form the free amine. | | Chemical Properties | White crystalline powder | | Uses | This is a crosslinker with a t-Boc protected amine on one end and a carboxyl group on the other end. The compound contains a single PEG unit to help improve solubility | | reaction suitability | reagent type: cross-linking reagent | | IC 50 | PEGs; Alkyl/ether |
| | Acetic acid, [2-[[(1,1-dimethylethoxy)carbonyl]amino]ethoxy]- (9CI) Preparation Products And Raw materials |
|