Carbamic acid, [(1S,3S)-3-aminocyclopentyl]-, 1,1-dimethylethyl ester (9CI) manufacturers
|
| | Carbamic acid, [(1S,3S)-3-aminocyclopentyl]-, 1,1-dimethylethyl ester (9CI) Basic information |
| Product Name: | Carbamic acid, [(1S,3S)-3-aminocyclopentyl]-, 1,1-dimethylethyl ester (9CI) | | Synonyms: | Carbamic acid, [(1S,3S)-3-aminocyclopentyl]-, 1,1-dimethylethyl ester (9CI);Carbamic acid, N-[(1S,3S)-3-aminocyclopentyl]-, 1,1-dimethylethyl ester;tert-butyl N-[(1S,3S)-3-aminocyclopentyl]carbamate;[(1S,3S)-3-Amino-1-(boc-amino)cyclopentane;TERT-BUTYL ((IS, 3S)-3- AMINOCYCLOPENTYL)CARBAMATE;1,1-Dimethylethyl N-[(1S,3S)-3-aminocyclopentyl]carbamate;tert-butyl ((1S,3S)-3-aminocyclopentyl)carbamate | | CAS: | 645400-44-8 | | MF: | C10H20N2O2 | | MW: | 200.28 | | EINECS: | | | Product Categories: | N-BOC;CYCLOPENTANE | | Mol File: | 645400-44-8.mol | ![Carbamic acid, [(1S,3S)-3-aminocyclopentyl]-, 1,1-dimethylethyl ester (9CI) Structure](CAS/GIF/645400-44-8.gif) |
| | Carbamic acid, [(1S,3S)-3-aminocyclopentyl]-, 1,1-dimethylethyl ester (9CI) Chemical Properties |
| Boiling point | 304.2±31.0 °C(Predicted) | | density | 1.04±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 12.37±0.40(Predicted) | | Appearance | off-white solid | | InChI | InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)12-8-5-4-7(11)6-8/h7-8H,4-6,11H2,1-3H3,(H,12,13)/t7-,8-/m0/s1 | | InChIKey | PGBVMVTUWHCOHX-YUMQZZPRSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@H]1CC[C@H](N)C1 |
| | Carbamic acid, [(1S,3S)-3-aminocyclopentyl]-, 1,1-dimethylethyl ester (9CI) Usage And Synthesis |
| Uses | tert-butyl N-[(1S,3S)-3-aminocyclopentyl]carbamate is used as a reactant in the synthesis of C-2 hydroxyethyl imidazopyrrolo pyridines as JAK1 inhibitors. | | Synthesis |  A flask containing tert-butyl [(1S,3S)-3-aminocyclopentyl]carbamate (16.5 g, crude ~0.05 mol) and 1.7 g Pd-C (10% paste) in MeOH (300 mL) was exposed to a positive pressure of hydrogen gas (balloon) over weekend. The catalyst was filtered off and the mixture was concentrated to afford the title compound (9.5 g) as a thick colorless viscous oil. Tert-butyl [(1S,3S)-3-aminocyclopentyl]carbamate, Yield (9.5 g) |
| | Carbamic acid, [(1S,3S)-3-aminocyclopentyl]-, 1,1-dimethylethyl ester (9CI) Preparation Products And Raw materials |
|