| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | N,N-Diethyl-p-toluamide Basic information |
| Product Name: | N,N-Diethyl-p-toluamide | | Synonyms: | N,N-Diethyl-p-toluamide;N,N-Diethyl-p-methylbenzamide;p-DETA;DiethyltoluaMide Related CoMpound A;Diethyltoluamide Related Compound A (N,N-Diethyl-4-toluamide) (1197018);N-Diethyl-p-toluamide;NSC 5686;NSC5686 | | CAS: | 2728-05-4 | | MF: | C12H17NO | | MW: | 191.27 | | EINECS: | | | Product Categories: | | | Mol File: | 2728-05-4.mol |  |
| | N,N-Diethyl-p-toluamide Chemical Properties |
| Melting point | 53-54 °C | | Boiling point | 163 °C(Press: 17 Torr) | | density | 0.985±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | -0.93±0.70(Predicted) | | color | White to Off-White | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C12H17NO/c1-4-13(5-2)12(14)11-8-6-10(3)7-9-11/h6-9H,4-5H2,1-3H3 | | InChIKey | PUZORFQMRDHKBT-UHFFFAOYSA-N | | SMILES | N(CC)(CC)C(=O)c1ccc(cc1)C |
| WGK Germany | WGK 3 | | RTECS | XS4025000 | | HS Code | 2924296000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | N,N-Diethyl-p-toluamide Usage And Synthesis |
| Uses | N,N-Diethyl-p-toluamide, is a buildig block used in the synthesis of phthalocyanines. It can also be used in preparation of new insect repellents. |
| | N,N-Diethyl-p-toluamide Preparation Products And Raw materials |
|