| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | N,N-Diethylbenzamide Basic information |
| Product Name: | N,N-Diethylbenzamide | | Synonyms: | Benzamide, N,N-diethyl-;Benzoic acid diethylamide;Benzoic acid N,N-diethylamide;benzoicaciddiethylamide;benzoicacidn,n-diethylamide;Benzoyldiethylamine;rrm2;N,N-Diethylbenzamide | | CAS: | 1696-17-9 | | MF: | C11H15NO | | MW: | 177.24 | | EINECS: | 216-912-9 | | Product Categories: | Miscellaneous | | Mol File: | 1696-17-9.mol |  |
| | N,N-Diethylbenzamide Chemical Properties |
| Melting point | 38-40°C | | Boiling point | 146-150°C 15mm | | density | 1.0290 (rough estimate) | | refractive index | 1.5240 to 1.5280 | | Fp | >100°C | | storage temp. | -20°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | clear liquid | | pka | -1.14±0.70(Predicted) | | color | White to Yellow to Green | | BRN | 1909505 | | InChI | InChI=1S/C11H15NO/c1-3-12(4-2)11(13)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 | | InChIKey | JLNGEXDJAQASHD-UHFFFAOYSA-N | | SMILES | C(N(CC)CC)(=O)C1=CC=CC=C1 | | CAS DataBase Reference | 1696-17-9(CAS DataBase Reference) | | EPA Substance Registry System | Benzamide, N,N-diethyl- (1696-17-9) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RTECS | CV4202000 | | TSCA | TSCA listed | | HS Code | 2924297099 | | Toxicity | LD50 oral in rat: 2gm/kg |
| Provider | Language |
|
ALFA
| English |
| | N,N-Diethylbenzamide Usage And Synthesis |
| Uses | N,N-Diethylbenzamide is used as an insect repellent. | | Definition | ChEBI: N,N-Diethylbenzamide is a member of benzamides. | | Synthesis Reference(s) | Chemistry Letters, 20, p. 615, 1991
Journal of the American Chemical Society, 111, p. 8742, 1989 DOI: 10.1021/ja00205a039
Tetrahedron Letters, 19, p. 5179, 1978 DOI: 10.1016/S0040-4039(01)85843-3 | | Safety Profile | Moderately toxic by ingestion andskin contact. When heated to decomposition it emits toxicfumes of NOx. |
| | N,N-Diethylbenzamide Preparation Products And Raw materials |
|