| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1,1,2,2-Tetramethylethylenediamine dihydrochloride Basic information |
| Product Name: | 1,1,2,2-Tetramethylethylenediamine dihydrochloride | | Synonyms: | 2,3-DIAMINO-2,3-DIMETHYLBUTANE DIHYDROCHLORIDE;2,3-Diamino-2,3-dimethylbutane Dihydrochloride
1,1,2,2-Tetramethylethylenediamine Dihydrochloride;2,3-dimethylbutane-2,3-diamine dihydrochloride;Clavulanic Acid Impurity 7 DiHCl;2,3-Dimethyl-2,3-butanediamineDihydrochloride>;2,3-Dimethyl-2,3-butanediamine diHCl;(3-Azaniumyl-2,3-dimethylbutan-2-yl)azanium Dichloride;2,3-Dimethyl-2,3-butanediamine dihydrochloride, 98+% | | CAS: | 75804-28-3 | | MF: | C6H18Cl2N2 | | MW: | 189.13 | | EINECS: | | | Product Categories: | | | Mol File: | 75804-28-3.mol |  |
| | 1,1,2,2-Tetramethylethylenediamine dihydrochloride Chemical Properties |
| storage temp. | 2-8°C | | Water Solubility | Soluble in water | | form | powder to crystal | | color | White to Almost white | | Major Application | pharmaceutical | | InChIKey | BRLVXFONMZRJCD-UHFFFAOYSA-N | | SMILES | [Cl-].[Cl-].[N+H3]C(C([N+H3])(C)C)(C)C |
| WGK Germany | WGK 3 | | HS Code | 2921.29.0055 | | Storage Class | 11 - Combustible Solids |
| | 1,1,2,2-Tetramethylethylenediamine dihydrochloride Usage And Synthesis |
| Uses | 2,3-Dimethyl-2,3-Butanediamine Dihydrochloride is intended for use in analytical testing to detect, identify, and measure pharmaceutical impurities. |
| | 1,1,2,2-Tetramethylethylenediamine dihydrochloride Preparation Products And Raw materials |
|