|
|
| | Codeine-d3 6-b-D-Glucuronide Basic information |
| | Codeine-d3 6-b-D-Glucuronide Chemical Properties |
| Melting point | 205-208°C (dec.) | | Boiling point | 713.367±60.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.561±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | Fp | 9℃ | | storage temp. | Controlled Substance, -20°C Freezer | | pka | 2.790±0.70(predicted) | | form | liquid | | Major Application | forensics and toxicology | | InChIKey | PXJIWCXZTGPMDS-WNCZEZBLSA-M | | SMILES | O[C@H]([C@H]1O)[C@H](O)[C@@H](C(O)=O)O[C@H]1O[C@@H](C=C2)[C@H]3[C@](C2[C@H]4C5)(CCN4C([2H])([2H])[2H])C6=C5C=CC(OC)=C6O3 |
| WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Flam. Liq. 2
STOT SE 1 |
| | Codeine-d3 6-b-D-Glucuronide Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | A labelled metabolite of Codeine (C634075). Analgesic (narcotic); antitussive. | | Uses | A labelled metabolite of Codeine. Analgesic (narcotic); antitussive | | General Description | An internal standard suitable for LC/MS or GC/MS applications with codeine-6-D-glucuronide such as forensic analysis, urine drug testing or clinical toxicology. Codeine-6-D-glucuronide is a major urinary metabolite of codeine, an opiate commonly used as an antitussive and analgesic for management of mild pain. This Certified Spiking Solution provides added value in allowing for quantitation of codeine-6-D-glucuronide levels by LC-MS/MS without the need for hydrolysis. |
| | Codeine-d3 6-b-D-Glucuronide Preparation Products And Raw materials |
|