| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Tetrakis(2,2,6,6-tetramethyl-3,5-heptanedionato)zirconium Basic information |
| Product Name: | Tetrakis(2,2,6,6-tetramethyl-3,5-heptanedionato)zirconium | | Synonyms: | Tetrakis(2,2,6,6-tetraMethyl-3,5-heptanedionato)zirconiuM(IV), 99.9%;Tetrakis(2,2,6,6-tetraMethyl-3,5-heptanedionato)zirconiuM(IV),98% Zr(TMHD)4;Zirconium(III)tetrakis(2,2,6,6-tetramethyl-3,5-heptanedionate);Tetrakis(2,2,6,6-tetraMethyl-3,5-heptanedionato)zirconiuM(IV), 99.99% (Metals basis);TETRAKIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATO)ZIRCONIUM(IV);ZIRCONIUM TETRAKIS (DIPIVALOYLMETHANATE);ZIRCONIUM TETRAKIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATE);ZIRCONIUM (IV) 2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATE | | CAS: | 18865-74-2 | | MF: | C44H76O8Zr | | MW: | 824.29 | | EINECS: | | | Product Categories: | metal beta-diketonate complexes;Zr | | Mol File: | 18865-74-2.mol |  |
| | Tetrakis(2,2,6,6-tetramethyl-3,5-heptanedionato)zirconium Chemical Properties |
| Melting point | 332-339 °C (lit.) | | Boiling point | 180°C 0,1mm | | Fp | 180°C/0.1mm subl. | | form | crystal | | color | white | | InChI | 1S/4C11H20O2.Zr/c4*1-10(2,3)8(12)7-9(13)11(4,5)6;/h4*7,12H,1-6H3;/q;;;;+4/p-4/b4*8-7-; | | InChIKey | MLSNEJQSDZMDFZ-DNSQIVDOSA-J | | SMILES | CC(C)(C)C(=O)\C=C(/O[Zr](O\C(=C/C(=O)C(C)(C)C)C(C)(C)C)(O\C(=C/C(=O)C(C)(C)C)C(C)(C)C)O\C(=C/C(=O)C(C)(C)C)C(C)(C)C)C(C)(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | No | | HS Code | 29310099 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Tetrakis(2,2,6,6-tetramethyl-3,5-heptanedionato)zirconium Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | MOCVD of zirconium | | Uses | Zirconium source precursor for good quality MOCVD of PNZT. | | General Description | Atomic number of base material: 40 Zirconium | | reaction suitability | core: zirconium |
| | Tetrakis(2,2,6,6-tetramethyl-3,5-heptanedionato)zirconium Preparation Products And Raw materials |
|