- Dopamine Impurity 47
-
- $0.00 / 10mg
-
2026-03-12
- CAS:
- Min. Order: 10mg
- Purity: 98%
- Supply Ability: 500mg
|
| | Phenyl-(2-pyridyl)acetamide Basic information |
| Product Name: | Phenyl-(2-pyridyl)acetamide | | Synonyms: | PHENYL-(2-PYRIDYL)ACETAMIDE;2-PHENYL-2-(2-PYRIDYL)ACETAMIDE;ALPHA-(2-PYRIDINYL) PHENYL ACETAMIDE;alpha-phenylpyridine-2-acetamide;-(2-PYRIDINYL)-PHENYLACETAMIDE;Ritalin Impurity 18;Methylphenidate EP Impurity F;2-Phenyl-(2-pyridyl)acetamide | | CAS: | 7251-52-7 | | MF: | C13H12N2O | | MW: | 212.25 | | EINECS: | 230-663-3 | | Product Categories: | Aromatics;Heterocycles;pharmacetical | | Mol File: | 7251-52-7.mol |  |
| | Phenyl-(2-pyridyl)acetamide Chemical Properties |
| Melting point | 136 °C | | Boiling point | 404.8±40.0 °C(Predicted) | | density | 1.178±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 15.48±0.50(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C13H12N2O/c14-13(16)12(10-6-2-1-3-7-10)11-8-4-5-9-15-11/h1-9,12H,(H2,14,16) | | InChIKey | PYAPITOPBTXXNJ-UHFFFAOYSA-N | | SMILES | C(C(=O)N)(C1=NC=CC=C1)C1C=CC=CC=1 | | LogP | 0.59 | | CAS DataBase Reference | 7251-52-7(CAS DataBase Reference) |
| RIDADR | UN 2811 6.1 / PGIII | | HS Code | 2933.39.9200 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3
toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | Phenyl-(2-pyridyl)acetamide Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | α-Phenyl-2-pyridineacetamide (cas# 7251-52-7) is a compound useful in organic synthesis. |
| | Phenyl-(2-pyridyl)acetamide Preparation Products And Raw materials |
|