| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:DiMethyl-d6-cyanaMide CAS:72142-88-2 Package:2.5g,250Mg
|
| Company Name: |
Shandong Xiya Chemical Co., Ltd
|
| Tel: |
13355009207 13355009207 |
| Email: |
3007715519@qq.com |
| Products Intro: |
CAS:72142-88-2 Purity:>=99.0% Package:1G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Dimethyl-d6-cyanamide CAS:72142-88-2 Purity:99 atom % D Package:1G Remarks:328472-1G
|
|
| | DIMETHYL-D6-CYANAMIDE Basic information |
| | DIMETHYL-D6-CYANAMIDE Chemical Properties |
| density | 0.941 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.4076(lit.) | | Fp | 137 °F | | storage temp. | Refrigerator | | solubility | DMSO, Methanol | | form | Oil | | color | Clear Colourless | | InChI | 1S/C3H6N2/c1-5(2)3-4/h1-2H3/i1D3,2D3 | | InChIKey | OAGOUCJGXNLJNL-WFGJKAKNSA-N | | SMILES | [2H]C([2H])([2H])N(C#N)C([2H])([2H])[2H] |
| Hazard Codes | T | | Risk Statements | 23/24/25-23/25 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 3275 6.1/PG 2 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral |
| | DIMETHYL-D6-CYANAMIDE Usage And Synthesis |
| Chemical Properties | Clear Colourless Oil | | Uses | Dimethyl-d6-cyanamide (cas# 72142-88-2) is a compound useful in organic synthesis. |
| | DIMETHYL-D6-CYANAMIDE Preparation Products And Raw materials |
|